Products 65901-04-4
CAS 65901-04-4 is the registry number for 1-Methylethyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg.
Propan-2-yl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (CAS 65901-04-4) is a chemical compound with the molecular formula C20H32O3 and a molecular weight of 320.5 g/mol. IUPAC name: propan-2-yl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate. InChIKey: PWWQZZFBTQYQDG-UHFFFAOYSA-N.
| Molecular formula | C20H32O3 |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | propan-2-yl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| InChIKey | PWWQZZFBTQYQDG-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)