CAS 6591-26-0 is the registry number for N–(DICHLOROBORYL)HEXAMETHYLDISILAZANE. Offered by: GLPBio. Available pack sizes: 10g.
[[dichloroboranyl(trimethylsilyl)amino]-dimethylsilyl]methane (CAS 6591-26-0) is a chemical compound with the molecular formula C6H18BCl2NSi2 and a molecular weight of 242.10 g/mol. IUPAC name: [[dichloroboranyl(trimethylsilyl)amino]-dimethylsilyl]methane. InChIKey: WRXQPKDWOCRQLR-UHFFFAOYSA-N.
| Molecular formula | C6H18BCl2NSi2 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | [[dichloroboranyl(trimethylsilyl)amino]-dimethylsilyl]methane |
| InChIKey | WRXQPKDWOCRQLR-UHFFFAOYSA-N |
| SMILES | B(N([Si](C)(C)C)[Si](C)(C)C)(Cl)Cl |
Computed by PubChem (NCBI)