CAS 65946-86-3 appears in our catalog under these names: Sodium 4-cyclohexylbenzenesulfinate 95%, Sodium 4-cyclohexylbenzenesulfinate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium 4-cyclohexylbenzenesulfinate (CAS 65946-86-3) is a chemical compound with the molecular formula C12H15NaO2S and a molecular weight of 246.30 g/mol. IUPAC name: sodium 4-cyclohexylbenzenesulfinate. InChIKey: PYVGHQAJVGBNJP-UHFFFAOYSA-M.
| Molecular formula | C12H15NaO2S |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | sodium 4-cyclohexylbenzenesulfinate |
| InChIKey | PYVGHQAJVGBNJP-UHFFFAOYSA-M |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)