Products 659727-22-7
CAS 659727-22-7 is the registry number for 2,6-Bis(pyridin-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetraone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis(pyridin-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (CAS 659727-22-7) is a chemical compound with the molecular formula C22H14N4O4 and a molecular weight of 398.4 g/mol. IUPAC name: 2,6-bis(pyridin-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone. InChIKey: DYRMZFDPYPCWFG-UHFFFAOYSA-N.
| Molecular formula | C22H14N4O4 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 2,6-bis(pyridin-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| InChIKey | DYRMZFDPYPCWFG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CN2C(=O)C3=CC4=C(C=C3C2=O)C(=O)N(C4=O)CC5=CC=CC=N5 |
Computed by PubChem (NCBI)