Products 65996-09-0
CAS 65996-09-0 is the registry number for 2-Bromo-4-methyl-3-(trifluoromethyl)pyridine, 95+%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-4-methyl-3-(trifluoromethyl)pyridine (CAS 65996-09-0) is a chemical compound with the molecular formula C7H5BrF3N and a molecular weight of 240.02 g/mol. IUPAC name: 2-bromo-4-methyl-3-(trifluoromethyl)pyridine. InChIKey: XGCSWVNSEVFLRA-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3N |
|---|---|
| Molecular weight | 240.02 g/mol |
| IUPAC name | 2-bromo-4-methyl-3-(trifluoromethyl)pyridine |
| InChIKey | XGCSWVNSEVFLRA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)