CAS 66-02-4 appears in our catalog under these names: 2-Amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid, 95%, 3,5-Diiodo-DL-tyrosine, >95% (HPLC), 2–Amino–3–(4–hydroxy–3,5–diiodophenyl)propanoic acid, 2-Amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid, 95%, 95%, 2-Amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid, 99.30%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 5g, 1g, 10mg, 250 mg, 100 mg.
2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CAS 66-02-4) is a chemical compound with the molecular formula C9H9I2NO3 and a molecular weight of 432.98 g/mol. IUPAC name: 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid. InChIKey: NYPYHUZRZVSYKL-UHFFFAOYSA-N.
| Molecular formula | C9H9I2NO3 |
|---|---|
| Molecular weight | 432.98 g/mol |
| IUPAC name | 2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| InChIKey | NYPYHUZRZVSYKL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)O)I)CC(C(=O)O)N |
Computed by PubChem (NCBI)