CAS 66009-35-6 appears in our catalog under these names: H–Tyr(Bzl)–OBzl · p–tosylate, O-Benzyl-L-tyrosine benzyl ester 4-toluenesulfonate. Offered by: GLPBio, Biosynth. Available pack sizes: 25g, 5g, 2g.
Benzyl (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoate;4-methylbenzenesulfonic acid (CAS 66009-35-6) is a chemical compound with the molecular formula C30H31NO6S and a molecular weight of 533.6 g/mol. IUPAC name: benzyl (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoate;4-methylbenzenesulfonic acid. InChIKey: CJHPRLKRQQBIRK-FTBISJDPSA-N.
| Molecular formula | C30H31NO6S |
|---|---|
| Molecular weight | 533.6 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoate;4-methylbenzenesulfonic acid |
| InChIKey | CJHPRLKRQQBIRK-FTBISJDPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)OCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)