CAS 66036-77-9 appears in our catalog under these names: N'-Nitro-D-Arginine, H–D–Arg(NO2)–OH, N'-Nitro-D-arginine/ 99.81% (existing batch purity), H-D-Arg(NO2)-OH, H-D-Arg(NO2)-OH 98%. Offered by: Chemat Brand, GLPBio, TargetMol, Iris Biotech, Ambeed. Available pack sizes: on request, 100g, 25g, 500mg, 5g, 10g, 1g, 100 g.
(2R)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoic acid (CAS 66036-77-9) is a chemical compound with the molecular formula C6H13N5O4 and a molecular weight of 219.20 g/mol. IUPAC name: (2R)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoic acid. InChIKey: MRAUNPAHJZDYCK-SCSAIBSYSA-N.
| Molecular formula | C6H13N5O4 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | (2R)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoic acid |
| InChIKey | MRAUNPAHJZDYCK-SCSAIBSYSA-N |
| SMILES | C(C[C@H](C(=O)O)N)CN=C(N)N[N+](=O)[O-] |
Computed by PubChem (NCBI)