CAS 66048-45-1 appears in our catalog under these names: 5-Fluorouracil N-Beta-D-Glucuronide, 5-Fluorouracil N-b-D-glucuronide. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg.
(2S,3S,4S,5R,6R)-6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 66048-45-1) is a chemical compound with the molecular formula C10H11FN2O8 and a molecular weight of 306.20 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: LKZGKOYOKVWGFN-UQGZVRACSA-N.
| Molecular formula | C10H11FN2O8 |
|---|---|
| Molecular weight | 306.20 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-6-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | LKZGKOYOKVWGFN-UQGZVRACSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O)F |
Computed by PubChem (NCBI)