CAS 66065-28-9 is the registry number for Azaperone N-Oxide. Offered by: Mikromol. Available pack sizes: 25mg.
1-(4-fluorophenyl)-4-(1-oxido-4-pyridin-2-ylpiperazin-1-ium-1-yl)butan-1-one (CAS 66065-28-9) is a chemical compound with the molecular formula C19H22FN3O2 and a molecular weight of 343.4 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-(1-oxido-4-pyridin-2-ylpiperazin-1-ium-1-yl)butan-1-one. InChIKey: LXVWCYCQAMQKDH-UHFFFAOYSA-N.
| Molecular formula | C19H22FN3O2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4-(1-oxido-4-pyridin-2-ylpiperazin-1-ium-1-yl)butan-1-one |
| InChIKey | LXVWCYCQAMQKDH-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1C2=CC=CC=N2)(CCCC(=O)C3=CC=C(C=C3)F)[O-] |
Computed by PubChem (NCBI)