CAS 6607-41-6 appears in our catalog under these names: 2,3-Dihydro-3,3-bis(4-hydroxyphenyl)-2-phenyl-1H-isoindol-1-one, 98%, 98%, 3,3-BIS(4-HYDROXYPHENYL)-2-PHENYLISOINDOLIN-1-ONE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3,3-bis(4-hydroxyphenyl)-2-phenylisoindol-1-one (CAS 6607-41-6) is a chemical compound with the molecular formula C26H19NO3 and a molecular weight of 393.4 g/mol. IUPAC name: 3,3-bis(4-hydroxyphenyl)-2-phenylisoindol-1-one. InChIKey: YBLBHSSRHHJKEK-UHFFFAOYSA-N.
| Molecular formula | C26H19NO3 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 3,3-bis(4-hydroxyphenyl)-2-phenylisoindol-1-one |
| InChIKey | YBLBHSSRHHJKEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C2(C4=CC=C(C=C4)O)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)