CAS 660870-17-7 is the registry number for 5-(2,2,2-Trifluoroacetamido)-2-methoxy-4-nitrophenyl pivalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[2-methoxy-4-nitro-5-[(2,2,2-trifluoroacetyl)amino]phenyl] 2,2-dimethylpropanoate (CAS 660870-17-7) is a chemical compound with the molecular formula C14H15F3N2O6 and a molecular weight of 364.27 g/mol. IUPAC name: [2-methoxy-4-nitro-5-[(2,2,2-trifluoroacetyl)amino]phenyl] 2,2-dimethylpropanoate. InChIKey: TXINDLGWFWVGSX-UHFFFAOYSA-N.
| Molecular formula | C14H15F3N2O6 |
|---|---|
| Molecular weight | 364.27 g/mol |
| IUPAC name | [2-methoxy-4-nitro-5-[(2,2,2-trifluoroacetyl)amino]phenyl] 2,2-dimethylpropanoate |
| InChIKey | TXINDLGWFWVGSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=C(C=C(C(=C1)NC(=O)C(F)(F)F)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)