CAS 66090-34-4 appears in our catalog under these names: 4-Bromobenzoyl isothiocyanate, 95%, 4-Bromo-N-(sulfanylidenemethylidene)benzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-bromobenzoyl isothiocyanate (CAS 66090-34-4) is a chemical compound with the molecular formula C8H4BrNOS and a molecular weight of 242.09 g/mol. IUPAC name: 4-bromobenzoyl isothiocyanate. InChIKey: UQIQCOFQWXQZRI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNOS |
|---|---|
| Molecular weight | 242.09 g/mol |
| IUPAC name | 4-bromobenzoyl isothiocyanate |
| InChIKey | UQIQCOFQWXQZRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N=C=S)Br |
Computed by PubChem (NCBI)