CAS 66107-33-3 is the registry number for m-Anisyl trifluoromethanesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
(3-methoxyphenyl) trifluoromethanesulfonate (CAS 66107-33-3) is a chemical compound with the molecular formula C8H7F3O4S and a molecular weight of 256.20 g/mol. IUPAC name: (3-methoxyphenyl) trifluoromethanesulfonate. InChIKey: OAMXTIOQCFCLRR-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O4S |
|---|---|
| Molecular weight | 256.20 g/mol |
| IUPAC name | (3-methoxyphenyl) trifluoromethanesulfonate |
| InChIKey | OAMXTIOQCFCLRR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)