Products 6611-46-7
CAS 6611-46-7 is the registry number for Cyclopentene-d8, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,2,3,3,4,4,5,5-octadeuteriocyclopentene (CAS 6611-46-7) is a chemical compound with the molecular formula C5H8 and a molecular weight of 76.17 g/mol. IUPAC name: 1,2,3,3,4,4,5,5-octadeuteriocyclopentene. InChIKey: LPIQUOYDBNQMRZ-DJVTXMRDSA-N.
| Molecular formula | C5H8 |
|---|---|
| Molecular weight | 76.17 g/mol |
| IUPAC name | 1,2,3,3,4,4,5,5-octadeuteriocyclopentene |
| InChIKey | LPIQUOYDBNQMRZ-DJVTXMRDSA-N |
| SMILES | [2H]C1=C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)