Products 66116-14-1

CAS 66116-14-1 is the registry number for tert-Butyl 2-(propylamino)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(propylamino)acetate (CAS 66116-14-1) is a chemical compound with the molecular formula C9H19NO2 and a molecular weight of 173.25 g/mol. IUPAC name: tert-butyl 2-(propylamino)acetate. InChIKey: HLPWJXUCXVCZHI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19NO2
Molecular weight173.25 g/mol
IUPAC nametert-butyl 2-(propylamino)acetate
InChIKeyHLPWJXUCXVCZHI-UHFFFAOYSA-N
SMILESCCCNCC(=O)OC(C)(C)C

Computed by PubChem (NCBI)