CAS 66141-97-7 is the registry number for (3R-cis)-1,3-Dimethyl-4-phenyl-4-piperidinol. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(3R)-1,3-dimethyl-4-phenylpiperidin-4-ol (CAS 66141-97-7) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: (3R)-1,3-dimethyl-4-phenylpiperidin-4-ol. InChIKey: YRQCJPVAIPXQDQ-JTDNENJMSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | (3R)-1,3-dimethyl-4-phenylpiperidin-4-ol |
| InChIKey | YRQCJPVAIPXQDQ-JTDNENJMSA-N |
| SMILES | C[C@@H]1CN(CCC1(C2=CC=CC=C2)O)C |
Computed by PubChem (NCBI)