CAS 66148-16-1 appears in our catalog under these names: Ethyl Nicotinate-d4, >95% (HPLC), Ethyl Nicotinate-2,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, 3-Pyridine-2,4,5,6-d4-carboxylic acid, ethyl ester. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 500mg, 1g, 0,5g, 100 mg, 50 mg, 500 mg.
Ethyl 2,4,5,6-tetradeuteriopyridine-3-carboxylate (CAS 66148-16-1) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 155.19 g/mol. IUPAC name: ethyl 2,4,5,6-tetradeuteriopyridine-3-carboxylate. InChIKey: XBLVHTDFJBKJLG-LNFUJOGGSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | ethyl 2,4,5,6-tetradeuteriopyridine-3-carboxylate |
| InChIKey | XBLVHTDFJBKJLG-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C(=O)OCC)[2H] |
Computed by PubChem (NCBI)