CAS 66160-25-6 is the registry number for ECIN. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-2-(4-chlorophenyl)-4-methyl-1,2-thiazol-3-one (CAS 66160-25-6) is a chemical compound with the molecular formula C10H7Cl2NOS and a molecular weight of 260.14 g/mol. IUPAC name: 5-chloro-2-(4-chlorophenyl)-4-methyl-1,2-thiazol-3-one. InChIKey: NCUQEDWZGMYONC-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NOS |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 5-chloro-2-(4-chlorophenyl)-4-methyl-1,2-thiazol-3-one |
| InChIKey | NCUQEDWZGMYONC-UHFFFAOYSA-N |
| SMILES | CC1=C(SN(C1=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)