CAS 66162-04-7 is the registry number for (S)-1-(2-(Diphenylphosphanyl)phenyl)-N,N-dimethylethan-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2-diphenylphosphanylphenyl)-N,N-dimethylethanamine (CAS 66162-04-7) is a chemical compound with the molecular formula C22H24NP and a molecular weight of 333.4 g/mol. IUPAC name: (1S)-1-(2-diphenylphosphanylphenyl)-N,N-dimethylethanamine. InChIKey: YFZVAVWYZTWAKA-SFHVURJKSA-N.
| Molecular formula | C22H24NP |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | (1S)-1-(2-diphenylphosphanylphenyl)-N,N-dimethylethanamine |
| InChIKey | YFZVAVWYZTWAKA-SFHVURJKSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)N(C)C |
Computed by PubChem (NCBI)