CAS 66164-06-5 appears in our catalog under these names: N-Didesmethyl Loperamide, >95% (HPLC), N-didesmethyl Loperamide. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg.
4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylbutanamide (CAS 66164-06-5) is a chemical compound with the molecular formula C27H29ClN2O2 and a molecular weight of 449.0 g/mol. IUPAC name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylbutanamide. InChIKey: PXJHDOGGBLQFRX-UHFFFAOYSA-N.
| Molecular formula | C27H29ClN2O2 |
|---|---|
| Molecular weight | 449.0 g/mol |
| IUPAC name | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylbutanamide |
| InChIKey | PXJHDOGGBLQFRX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCC(C3=CC=CC=C3)(C4=CC=CC=C4)C(=O)N |
Computed by PubChem (NCBI)