CAS 66181-17-7 is the registry number for 1-(5-(Trifluoromethyl)-1,3,4-thiadiazol-2-yl)thiourea, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]thiourea (CAS 66181-17-7) is a chemical compound with the molecular formula C4H3F3N4S2 and a molecular weight of 228.2 g/mol. IUPAC name: [5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]thiourea. InChIKey: RIFPTLSDENCJNY-UHFFFAOYSA-N.
| Molecular formula | C4H3F3N4S2 |
|---|---|
| Molecular weight | 228.2 g/mol |
| IUPAC name | [5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]thiourea |
| InChIKey | RIFPTLSDENCJNY-UHFFFAOYSA-N |
| SMILES | C1(=NN=C(S1)NC(=S)N)C(F)(F)F |
Computed by PubChem (NCBI)