CAS 662-62-4 is the registry number for 7-Chloroperfluoroheptanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-chloro-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl chloride (CAS 662-62-4) is a chemical compound with the molecular formula C7Cl2F12O and a molecular weight of 398.96 g/mol. IUPAC name: 7-chloro-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl chloride. InChIKey: UXMNQDVITLEYEF-UHFFFAOYSA-N.
| Molecular formula | C7Cl2F12O |
|---|---|
| Molecular weight | 398.96 g/mol |
| IUPAC name | 7-chloro-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl chloride |
| InChIKey | UXMNQDVITLEYEF-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)