CAS 662108-92-1 is the registry number for 3-Amino-3-(trifluoromethyl)piperidin-2-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3-amino-3-(trifluoromethyl)piperidin-2-one (CAS 662108-92-1) is a chemical compound with the molecular formula C6H9F3N2O and a molecular weight of 182.14 g/mol. IUPAC name: 3-amino-3-(trifluoromethyl)piperidin-2-one. InChIKey: HVRIFCKBSBHELV-UHFFFAOYSA-N.
| Molecular formula | C6H9F3N2O |
|---|---|
| Molecular weight | 182.14 g/mol |
| IUPAC name | 3-amino-3-(trifluoromethyl)piperidin-2-one |
| InChIKey | HVRIFCKBSBHELV-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)NC1)(C(F)(F)F)N |
Computed by PubChem (NCBI)