CAS 662116-66-7 appears in our catalog under these names: 4,5-Dichloropyridine-2,3-diamine, 95%, 4,5-Dichloropyridine-2,3-diamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4,5-dichloropyridine-2,3-diamine (CAS 662116-66-7) is a chemical compound with the molecular formula C5H5Cl2N3 and a molecular weight of 178.02 g/mol. IUPAC name: 4,5-dichloropyridine-2,3-diamine. InChIKey: GOVJRSTWOQZULF-UHFFFAOYSA-N.
| Molecular formula | C5H5Cl2N3 |
|---|---|
| Molecular weight | 178.02 g/mol |
| IUPAC name | 4,5-dichloropyridine-2,3-diamine |
| InChIKey | GOVJRSTWOQZULF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)N)Cl)Cl |
Computed by PubChem (NCBI)