CAS 66212-83-7 is the registry number for 2-Methylthio-6-chloropurine riboside. Offered by: Biosynth. Available pack sizes: 5mg, 1mg, 10mg.
(2R,3R,4S,5R)-2-(6-chloro-2-methylsulfanylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 66212-83-7) is a chemical compound with the molecular formula C11H13ClN4O4S and a molecular weight of 332.76 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-chloro-2-methylsulfanylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: OAMKRDXWXFNNRI-KQYNXXCUSA-N.
| Molecular formula | C11H13ClN4O4S |
|---|---|
| Molecular weight | 332.76 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-chloro-2-methylsulfanylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | OAMKRDXWXFNNRI-KQYNXXCUSA-N |
| SMILES | CSC1=NC2=C(C(=N1)Cl)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)