CAS 662149-10-2 is the registry number for Duloxetine Impurity 27. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Sodium [2-methoxy-5-[(1S)-3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-yl] sulfate (CAS 662149-10-2) is a chemical compound with the molecular formula C19H20NNaO6S2 and a molecular weight of 445.5 g/mol. IUPAC name: sodium [2-methoxy-5-[(1S)-3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-yl] sulfate. InChIKey: ZYSPQRLLQVFKDB-NTISSMGPSA-M.
| Molecular formula | C19H20NNaO6S2 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | sodium [2-methoxy-5-[(1S)-3-(methylamino)-1-thiophen-2-ylpropoxy]naphthalen-1-yl] sulfate |
| InChIKey | ZYSPQRLLQVFKDB-NTISSMGPSA-M |
| SMILES | CNCC[C@@H](C1=CC=CS1)OC2=CC=CC3=C2C=CC(=C3OS(=O)(=O)[O-])OC.[Na+] |
Computed by PubChem (NCBI)