Products 662151-10-2
CAS 662151-10-2 is the registry number for ML-220. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole (CAS 662151-10-2) is a chemical compound with the molecular formula C23H14BrN3 and a molecular weight of 412.3 g/mol. IUPAC name: 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole. InChIKey: XFVVNPCUAYGFFE-UHFFFAOYSA-N.
| Molecular formula | C23H14BrN3 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | 2-(5-bromo-1H-indol-3-yl)-1H-phenanthro[9,10-d]imidazole |
| InChIKey | XFVVNPCUAYGFFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=C2NC(=N4)C5=CNC6=C5C=C(C=C6)Br |
Computed by PubChem (NCBI)