CAS 66233-86-1 appears in our catalog under these names: 7-(Aminomethyl)-5-chloroquinolin-8-ol dihydrochloride, 95%, 7-(Aminomethyl)-5-chloroquinolin-8-ol dihydrochloride, 7-(Aminomethyl)-5-chloroquinolin-8-ol dihydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 50mg, 0,5g, 100mg.
7-(aminomethyl)-5-chloroquinolin-8-ol;dihydrochloride (CAS 66233-86-1) is a chemical compound with the molecular formula C10H11Cl3N2O and a molecular weight of 281.6 g/mol. IUPAC name: 7-(aminomethyl)-5-chloroquinolin-8-ol;dihydrochloride. InChIKey: RPQRZEDKTZLEEN-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl3N2O |
|---|---|
| Molecular weight | 281.6 g/mol |
| IUPAC name | 7-(aminomethyl)-5-chloroquinolin-8-ol;dihydrochloride |
| InChIKey | RPQRZEDKTZLEEN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C(=C2N=C1)O)CN)Cl.Cl.Cl |
Computed by PubChem (NCBI)