Products 66236-36-0
CAS 66236-36-0 is the registry number for rac-(1R,3R)-3-Acetyl-2,2-dimethylcyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Trans-(1R,3R)-3-acetyl-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 66236-36-0) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: trans-(1R,3R)-3-acetyl-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: DBIPVNZNXKVLTL-RITPCOANSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | trans-(1R,3R)-3-acetyl-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | DBIPVNZNXKVLTL-RITPCOANSA-N |
| SMILES | CC(=O)[C@@H]1[C@H](C1(C)C)C(=O)O |
Computed by PubChem (NCBI)