CAS 6626-68-2 is the registry number for 2,6-Diphenylpyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetraone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-diphenylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (CAS 6626-68-2) is a chemical compound with the molecular formula C22H12N2O4 and a molecular weight of 368.3 g/mol. IUPAC name: 2,6-diphenylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone. InChIKey: KTFOPJDWCAMBFN-UHFFFAOYSA-N.
| Molecular formula | C22H12N2O4 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 2,6-diphenylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| InChIKey | KTFOPJDWCAMBFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC4=C(C=C3C2=O)C(=O)N(C4=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)