CAS 66270-36-8 appears in our catalog under these names: 2,2,2–Trichloro–1,1–dimethylethyl chloroformate, 2,2,2-TRICHLORO-1,1-DIMETHYLETHYL, 2,2,2-TRICHLORO-1,1-DIMETHYLETHYL &, 2,2,2-TRICHLORO-1,1-DIMETHYLETHYL CHLOROFORMATE, 97%. Offered by: GLPBio, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 5g.
(1,1,1-trichloro-2-methylpropan-2-yl) carbonochloridate (CAS 66270-36-8) is a chemical compound with the molecular formula C5H6Cl4O2 and a molecular weight of 239.9 g/mol. IUPAC name: (1,1,1-trichloro-2-methylpropan-2-yl) carbonochloridate. InChIKey: GMELMFSDPDSXOZ-UHFFFAOYSA-N.
| Molecular formula | C5H6Cl4O2 |
|---|---|
| Molecular weight | 239.9 g/mol |
| IUPAC name | (1,1,1-trichloro-2-methylpropan-2-yl) carbonochloridate |
| InChIKey | GMELMFSDPDSXOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(Cl)(Cl)Cl)OC(=O)Cl |
Computed by PubChem (NCBI)