CAS 6629-96-5 appears in our catalog under these names: 2,2,3,3,5,5,6-Heptachloro-1,4-dioxane, 95%, 2,2,3,3,5,5,6-Heptachloro-1,4-dioxane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,2,3,3,5,5,6-heptachloro-1,4-dioxane (CAS 6629-96-5) is a chemical compound with the molecular formula C4HCl7O2 and a molecular weight of 329.2 g/mol. IUPAC name: 2,2,3,3,5,5,6-heptachloro-1,4-dioxane. InChIKey: QESFVSBDBUGOEW-UHFFFAOYSA-N.
| Molecular formula | C4HCl7O2 |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | 2,2,3,3,5,5,6-heptachloro-1,4-dioxane |
| InChIKey | QESFVSBDBUGOEW-UHFFFAOYSA-N |
| SMILES | C1(C(OC(C(O1)(Cl)Cl)(Cl)Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)