CAS 663-78-5 is the registry number for methyl 2,3,3,3-tetrafluoro-2-(fluorosulfonyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Methyl 2,3,3,3-tetrafluoro-2-fluorosulfonylpropanoate (CAS 663-78-5) is a chemical compound with the molecular formula C4H3F5O4S and a molecular weight of 242.12 g/mol. IUPAC name: methyl 2,3,3,3-tetrafluoro-2-fluorosulfonylpropanoate. InChIKey: KSERMEXIFUORJL-UHFFFAOYSA-N.
| Molecular formula | C4H3F5O4S |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | methyl 2,3,3,3-tetrafluoro-2-fluorosulfonylpropanoate |
| InChIKey | KSERMEXIFUORJL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(F)(F)F)(F)S(=O)(=O)F |
Computed by PubChem (NCBI)