CAS 6630-30-4 appears in our catalog under these names: 6–Chloro–5–nitropyrimidine–2,4(1H,3H)–dione, 6-Chloro-5-nitropyrimidine-2,4-diol 97%, 6-Chloro-5-nitro-pyrimidine-2,4-diol, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-chloro-5-nitro-1H-pyrimidine-2,4-dione (CAS 6630-30-4) is a chemical compound with the molecular formula C4H2ClN3O4 and a molecular weight of 191.53 g/mol. IUPAC name: 6-chloro-5-nitro-1H-pyrimidine-2,4-dione. InChIKey: GPFMSTOIHBOPQA-UHFFFAOYSA-N.
| Molecular formula | C4H2ClN3O4 |
|---|---|
| Molecular weight | 191.53 g/mol |
| IUPAC name | 6-chloro-5-nitro-1H-pyrimidine-2,4-dione |
| InChIKey | GPFMSTOIHBOPQA-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)