CAS 6630-65-5 appears in our catalog under these names: 9-Chlorofluorene, 95%, 9-Chlorofluorene, >95% (HPLC), 9-Chloro-9H-fluorene, 95+%, 9-Chlorofluorene, Fluorene, 9-chloro- (6CI,7CI,8CI), 98%, 98%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 100mg, 25g, 250mg.
9-chloro-9H-fluorene (CAS 6630-65-5) is a chemical compound with the molecular formula C13H9Cl and a molecular weight of 200.66 g/mol. IUPAC name: 9-chloro-9H-fluorene. InChIKey: CVCQMAKDIKSUHX-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 9-chloro-9H-fluorene |
| InChIKey | CVCQMAKDIKSUHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)