CAS 663194-12-5 is the registry number for 2-(tert-Butyl)pyrimidine-4,5,6-triamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butylpyrimidine-4,5,6-triamine (CAS 663194-12-5) is a chemical compound with the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. IUPAC name: 2-tert-butylpyrimidine-4,5,6-triamine. InChIKey: RGOCIAXXMTUKIN-UHFFFAOYSA-N.
| Molecular formula | C8H15N5 |
|---|---|
| Molecular weight | 181.24 g/mol |
| IUPAC name | 2-tert-butylpyrimidine-4,5,6-triamine |
| InChIKey | RGOCIAXXMTUKIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=C(C(=N1)N)N)N |
Computed by PubChem (NCBI)