CAS 6632-09-3 is the registry number for NSC-57969. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
7-(piperidin-1-ylmethyl)quinolin-8-ol (CAS 6632-09-3) is a chemical compound with the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. IUPAC name: 7-(piperidin-1-ylmethyl)quinolin-8-ol. InChIKey: WXMFPLZGDXLEMN-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O |
|---|---|
| Molecular weight | 242.32 g/mol |
| IUPAC name | 7-(piperidin-1-ylmethyl)quinolin-8-ol |
| InChIKey | WXMFPLZGDXLEMN-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=C(C3=C(C=CC=N3)C=C2)O |
Computed by PubChem (NCBI)