Products 6633-69-8
CAS 6633-69-8 is the registry number for N4-(4-Bromophenyl)-6-methylpyrimidine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-(4-bromophenyl)-6-methylpyrimidine-2,4-diamine (CAS 6633-69-8) is a chemical compound with the molecular formula C11H11BrN4 and a molecular weight of 279.14 g/mol. IUPAC name: 4-N-(4-bromophenyl)-6-methylpyrimidine-2,4-diamine. InChIKey: DXBSNDAVNFWNTI-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN4 |
|---|---|
| Molecular weight | 279.14 g/mol |
| IUPAC name | 4-N-(4-bromophenyl)-6-methylpyrimidine-2,4-diamine |
| InChIKey | DXBSNDAVNFWNTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)