CAS 6634-82-8 appears in our catalog under these names: 4-Amino-4'-nitrostilbene-2,2'-disulfonic Acid Disodium Salt, Disodium 4–Amino–4'–nitrostilbene–2,2'–sulfonate, 4-Amino-4'-nitrostilbene-2,2'-disulfonic acid disodium. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 1g, 2,5g, 2g, 25g, 10g, 5g, 50g, 100g.
Disodium;5-amino-2-[(E)-2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate (CAS 6634-82-8) is a chemical compound with the molecular formula C14H10N2Na2O8S2 and a molecular weight of 444.4 g/mol. IUPAC name: disodium;5-amino-2-[(E)-2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate. InChIKey: RXYPPHDUSQFWID-SEPHDYHBSA-L.
| Molecular formula | C14H10N2Na2O8S2 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | disodium;5-amino-2-[(E)-2-(4-nitro-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| InChIKey | RXYPPHDUSQFWID-SEPHDYHBSA-L |
| SMILES | C1=CC(=C(C=C1N)S(=O)(=O)[O-])/C=C/C2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)