CAS 66364-71-4 appears in our catalog under these names: Sulfasalazine EP Impurity F, Sulfasalazine 3-Isomer, >95% (HPLC), 3-((p-(2-Pyridylsulfamoyl)phenyl)azo)salicylic acid, SULFASALAZINE 3-ISOMER. Offered by: Chemat Brand, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 50mg, 25mg, 100mg.
2-hydroxy-3-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid (CAS 66364-71-4) is a chemical compound with the molecular formula C18H14N4O5S and a molecular weight of 398.4 g/mol. IUPAC name: 2-hydroxy-3-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid. InChIKey: RQKGJJSJEOATBZ-UHFFFAOYSA-N.
| Molecular formula | C18H14N4O5S |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 2-hydroxy-3-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoic acid |
| InChIKey | RQKGJJSJEOATBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N=NC3=CC=CC(=C3O)C(=O)O |
Computed by PubChem (NCBI)