CAS 66364-73-6 appears in our catalog under these names: Enpiroline, >95% (HPLC), Enpiroline. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 2mg, 25mg, 50mg.
(R)-[(2R)-piperidin-2-yl]-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]methanol (CAS 66364-73-6) is a chemical compound with the molecular formula C19H18F6N2O and a molecular weight of 404.3 g/mol. IUPAC name: (R)-[(2R)-piperidin-2-yl]-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]methanol. InChIKey: OCVRKDMRZFCUEE-RHSMWYFYSA-N.
| Molecular formula | C19H18F6N2O |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | (R)-[(2R)-piperidin-2-yl]-[2-(trifluoromethyl)-6-[4-(trifluoromethyl)phenyl]-4-pyridinyl]methanol |
| InChIKey | OCVRKDMRZFCUEE-RHSMWYFYSA-N |
| SMILES | C1CCN[C@H](C1)[C@@H](C2=CC(=NC(=C2)C(F)(F)F)C3=CC=C(C=C3)C(F)(F)F)O |
Computed by PubChem (NCBI)