CAS 66393-34-8 is the registry number for 1,4-Dithiane-2,3,5,6-tetracarbonitril. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dithiane-2,3,5,6-tetracarbonitrile (CAS 66393-34-8) is a chemical compound with the molecular formula C8H4N4S2 and a molecular weight of 220.3 g/mol. IUPAC name: 1,4-dithiane-2,3,5,6-tetracarbonitrile. InChIKey: BCRRMLNNQLPYOH-UHFFFAOYSA-N.
| Molecular formula | C8H4N4S2 |
|---|---|
| Molecular weight | 220.3 g/mol |
| IUPAC name | 1,4-dithiane-2,3,5,6-tetracarbonitrile |
| InChIKey | BCRRMLNNQLPYOH-UHFFFAOYSA-N |
| SMILES | C(#N)C1C(SC(C(S1)C#N)C#N)C#N |
Computed by PubChem (NCBI)