CAS 6640-22-8 appears in our catalog under these names: Pamoic acid disodium salt, 98%, Embonic acid disodium salt monohydrate, 95%, Pamoic acid disodium salt, Disodium pamoate, Pamoic Acid Disodium Salt Monohydrate, >98.0%(HPLC). Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 500g, 1kg, 100g, 5g, 50mg, 0,5kg, 250g.
Disodium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate (CAS 6640-22-8) is a chemical compound with the molecular formula C23H14Na2O6 and a molecular weight of 432.3 g/mol. IUPAC name: disodium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate. InChIKey: YGLLICRFEVEWOZ-UHFFFAOYSA-L.
| Molecular formula | C23H14Na2O6 |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | disodium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate |
| InChIKey | YGLLICRFEVEWOZ-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)[O-])[O-])C(=O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)