CAS 6640-90-0 appears in our catalog under these names: NSC 48160, 97%, NSC 48160, NSC 48160, 99.75%, 4-(tert-Butyl)-2-((cyclohexylamino)methyl)-6-methylphenol, 97%, NSC 48160, 99%. Offered by: AmBeed, GLPBio, MedChemExpress, BLDpharm, Chemat. Available pack sizes: 5mg, 10mg, 100 mg, 5 mg, 50 mg, 10 mg, 25 mg, 10mM/1mL.
4-tert-butyl-2-[(cyclohexylamino)methyl]-6-methylphenol (CAS 6640-90-0) is a chemical compound with the molecular formula C18H29NO and a molecular weight of 275.4 g/mol. IUPAC name: 4-tert-butyl-2-[(cyclohexylamino)methyl]-6-methylphenol. InChIKey: DVMJYVSFWOSELO-UHFFFAOYSA-N.
| Molecular formula | C18H29NO |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | 4-tert-butyl-2-[(cyclohexylamino)methyl]-6-methylphenol |
| InChIKey | DVMJYVSFWOSELO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)CNC2CCCCC2)C(C)(C)C |
Computed by PubChem (NCBI)