CAS 664340-50-5 is the registry number for 4-Amino-3,5-diisopropylbenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3,5-di(propan-2-yl)benzaldehyde (CAS 664340-50-5) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: 4-amino-3,5-di(propan-2-yl)benzaldehyde. InChIKey: ILZBISIHWGTQJJ-UHFFFAOYSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 4-amino-3,5-di(propan-2-yl)benzaldehyde |
| InChIKey | ILZBISIHWGTQJJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)C=O |
Computed by PubChem (NCBI)