CAS 66470-81-3 appears in our catalog under these names: Tris(1,1,1,3,3,3-hexafluoro-2-propyl) phosphite, 98%, Tris(1,1,1,3,3,3–hexafluoro–2–propyl) Phosphite, Tris(1,1,1,3,3,3-hexafluoro-2-propyl) Phosphite, >98.0%(GC), Tris(1,1,1,3,3,3-hexafluoro-2-propyl)phosphite 98%, TRIS(1,1,1,3,3,3-HEXAFLUORO-2-PROPYL). Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 200mg.
Tris(1,1,1,3,3,3-hexafluoropropan-2-yl) phosphite (CAS 66470-81-3) is a chemical compound with the molecular formula C9H3F18O3P and a molecular weight of 532.06 g/mol. IUPAC name: tris(1,1,1,3,3,3-hexafluoropropan-2-yl) phosphite. InChIKey: MJOVEPJSFHDSOJ-UHFFFAOYSA-N.
| Molecular formula | C9H3F18O3P |
|---|---|
| Molecular weight | 532.06 g/mol |
| IUPAC name | tris(1,1,1,3,3,3-hexafluoropropan-2-yl) phosphite |
| InChIKey | MJOVEPJSFHDSOJ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)OP(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)