Products 66476-29-7

CAS 66476-29-7 is the registry number for 2,4-Dimethoxy-1-((trifluoromethyl)thio)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2,4-dimethoxy-1-(trifluoromethylsulfanyl)benzene (CAS 66476-29-7) is a chemical compound with the molecular formula C9H9F3O2S and a molecular weight of 238.23 g/mol. IUPAC name: 2,4-dimethoxy-1-(trifluoromethylsulfanyl)benzene. InChIKey: VSTIBTUDCMFXMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9F3O2S
Molecular weight238.23 g/mol
IUPAC name2,4-dimethoxy-1-(trifluoromethylsulfanyl)benzene
InChIKeyVSTIBTUDCMFXMQ-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)SC(F)(F)F)OC

Computed by PubChem (NCBI)