CAS 66493-42-3 appears in our catalog under these names: H–Gly–Gly–pNA · HCl, H-Gly-Gly-pNA·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg.
2-amino-N-[2-(4-nitroanilino)-2-oxoethyl]acetamide;hydrochloride (CAS 66493-42-3) is a chemical compound with the molecular formula C10H13ClN4O4 and a molecular weight of 288.69 g/mol. IUPAC name: 2-amino-N-[2-(4-nitroanilino)-2-oxoethyl]acetamide;hydrochloride. InChIKey: CKLOAMFWKWPQOR-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4O4 |
|---|---|
| Molecular weight | 288.69 g/mol |
| IUPAC name | 2-amino-N-[2-(4-nitroanilino)-2-oxoethyl]acetamide;hydrochloride |
| InChIKey | CKLOAMFWKWPQOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CNC(=O)CN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)