CAS 665-27-0 appears in our catalog under these names: (-)-Quinic Acid Gamma-Lactone, (1S,3R,4R,5R)-1,3,4-Trihydroxy-6-oxabicyclo(3.2.1)octan-7-one. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg, 500mg.
(1S,3R,4R,5R)-1,3,4-trihydroxy-6-oxabicyclo[3.2.1]octan-7-one (CAS 665-27-0) is a chemical compound with the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. IUPAC name: (1S,3R,4R,5R)-1,3,4-trihydroxy-6-oxabicyclo[3.2.1]octan-7-one. InChIKey: QPJRIFFWEBJVFN-WYWMIBKRSA-N.
| Molecular formula | C7H10O5 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | (1S,3R,4R,5R)-1,3,4-trihydroxy-6-oxabicyclo[3.2.1]octan-7-one |
| InChIKey | QPJRIFFWEBJVFN-WYWMIBKRSA-N |
| SMILES | C1[C@H]([C@H]([C@H]2C[C@@]1(C(=O)O2)O)O)O |
Computed by PubChem (NCBI)